
CAS 952234-37-6
:1H-Imidazole-1-sulfonyl azide
Description:
1H-Imidazole-1-sulfonyl azide is a chemical compound characterized by its unique structure, which includes an imidazole ring and a sulfonyl azide functional group. This compound typically appears as a solid and is known for its reactivity, particularly due to the presence of the azide group, which can undergo various chemical transformations, including cycloaddition and nucleophilic substitution reactions. The sulfonyl group enhances its electrophilic properties, making it useful in organic synthesis and as a potential building block for more complex molecules. Additionally, 1H-Imidazole-1-sulfonyl azide may exhibit properties such as solubility in polar solvents and stability under specific conditions, although it should be handled with care due to the potential hazards associated with azides, including their sensitivity to heat and shock. Overall, this compound is of interest in the fields of medicinal chemistry and materials science for its versatile reactivity and potential applications in drug development and polymer chemistry.
Formula:C3H3N5O2S
InChI:InChI=1S/C3H3N5O2S/c4-6-7-11(9,10)8-2-1-5-3-8/h1-3H
InChI key:InChIKey=GFRDSYFROJUKBF-UHFFFAOYSA-N
SMILES:S(N=[N+]=[N-])(=O)(=O)N1C=CN=C1
Synonyms:- 1H-Imidazole-1-sulfonyl azide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.