CymitQuimica logo

CAS 95234-76-7

:

Benzenesulfonamide, 3-hydroxy-5-methoxy-

Description:
Benzenesulfonamide, 3-hydroxy-5-methoxy- is an organic compound characterized by the presence of a sulfonamide group attached to a benzene ring, which is further substituted with hydroxy and methoxy groups. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity may vary. The hydroxy group contributes to its polarity and solubility in polar solvents, while the methoxy group can influence its electronic properties and reactivity. The presence of these functional groups suggests that the compound may participate in hydrogen bonding and other intermolecular interactions. Additionally, the compound's structure may allow for various synthetic modifications, making it of interest in medicinal chemistry and drug development. Its CAS number, 95234-76-7, provides a unique identifier for regulatory and research purposes, facilitating its identification in chemical databases and literature. Overall, this compound exemplifies the diverse chemistry of sulfonamides and their derivatives.
Formula:C7H9NO4S
InChI:InChI=1S/C7H9NO4S/c1-12-6-2-5(9)3-7(4-6)13(8,10)11/h2-4,9H,1H3,(H2,8,10,11)
InChI key:InChIKey=GKZXBOVZQZWWSF-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC(OC)=CC(O)=C1
Synonyms:
  • 3-Hydroxy-5-methoxybenzenesulfonamide
  • 3-Hydroxy-5-methoxybenzene-1-sulfonamide
  • Benzenesulfonamide, 3-hydroxy-5-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.