CAS 952417-63-9

Ethyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-pyrrole-2-carboxylate

Description:

Ethyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-pyrrole-2-carboxylate, with the CAS number 952417-63-9, is a chemical compound characterized by its complex structure, which includes a pyrrole ring, an ethyl ester group, and a dimethylethoxycarbonyl substituent. This compound typically exhibits properties associated with both pyrrole derivatives and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The dimethylethoxycarbonyl moiety can influence its stability and reactivity, making it a candidate for various synthetic applications in organic chemistry. Additionally, the presence of the amino group suggests potential for further derivatization or interaction in biological systems. Its unique structure may confer specific biological activities, making it of interest in medicinal chemistry and drug development. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₂H₁₈N₂O₄

InChI: InChI=1S/C12H18N2O4/c1-5-17-10(15)9-8(6-7-13-9)14-11(16)18-12(2,3)4/h6-7,13H,5H2,1-4H3,(H,14,16)

InChI key: InChIKey=SNPMOXPMDVCCEM-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=C(C(OCC)=O)NC=C1

Synonyms:

• 1H-Pyrrole-2-carboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, ethyl ester
• Ethyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-1H-pyrrole-2-carboxylate