CAS 952480-26-1

(3S,4R)-3-benzyl-1-methyl-piperidin-4-amine

Description:

(3S,4R)-3-benzyl-1-methyl-piperidin-4-amine is a chiral piperidine derivative characterized by its specific stereochemistry at the 3 and 4 positions of the piperidine ring. The presence of a benzyl group at the 3-position and a methyl group at the 1-position contributes to its unique chemical properties and potential biological activity. This compound is likely to exhibit basic properties due to the amine functional group, which can participate in hydrogen bonding and interact with various biological targets. Its stereochemistry suggests that it may have distinct pharmacological effects, as chirality often influences the interaction of molecules with biological receptors. The compound's structure may allow it to cross biological membranes, making it of interest in medicinal chemistry and drug development. Additionally, its CAS number, 952480-26-1, provides a unique identifier for regulatory and research purposes, facilitating its study in various chemical and pharmaceutical contexts.

Formula: C₁₃H₂₀N₂

InChI: InChI=1/C13H20N2/c1-15-8-7-13(14)12(10-15)9-11-5-3-2-4-6-11/h2-6,12-13H,7-10,14H2,1H3/t12-,13+/m0/s1