CymitQuimica logo

CAS 952480-32-9

:

2-(9-tert-butoxycarbonyl-9-azaspiro[5.5]undecan-3-yl)acetic acid

Description:
2-(9-tert-butoxycarbonyl-9-azaspiro[5.5]undecan-3-yl)acetic acid is a chemical compound characterized by its unique structural features, including a spirocyclic framework and a carboxylic acid functional group. The presence of the tert-butoxycarbonyl (Boc) group indicates that this compound is likely used in organic synthesis, particularly in the protection of amines during chemical reactions. The spirocyclic structure contributes to its potential biological activity, as such configurations can influence the compound's interaction with biological targets. The carboxylic acid moiety suggests that it may exhibit acidic properties, which can affect its solubility and reactivity in various solvents. Additionally, the compound's molecular weight and specific stereochemistry can play significant roles in its pharmacokinetics and pharmacodynamics if it is evaluated for therapeutic applications. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those designed for specific functions in medicinal chemistry or materials science.
Formula:C17H29NO4
InChI:InChI=1/C17H29NO4/c1-16(2,3)22-15(21)18-10-8-17(9-11-18)6-4-13(5-7-17)12-14(19)20/h13H,4-12H2,1-3H3,(H,19,20)
InChI key:SKPPKBVHYIOFPC-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CCC(CC2)CC(=O)O)CC1
Synonyms:
  • 2-(3-(Tert-Butoxycarbonyl)-3-Azaspiro[5.5]Undecane-9-Yl)Acetic Acid
Found 5 products.