CAS 952578-22-2
:(E)-1-(4-Aminophenyl)-3-(2-chlorophenyl)-2-propen-1-one
Description:
(E)-1-(4-Aminophenyl)-3-(2-chlorophenyl)-2-propen-1-one, also known as a derivative of chalcone, is an organic compound characterized by its conjugated double bond system, which contributes to its potential biological activity. This compound features an α,β-unsaturated carbonyl group, which is significant in various chemical reactions, including Michael additions and aldol condensations. The presence of the 4-aminophenyl group suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. The 2-chlorophenyl substituent may influence the compound's electronic properties and steric hindrance, affecting its reactivity and biological activity. Typically, such compounds exhibit properties like moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. The compound's structure allows for potential applications in pharmaceuticals, particularly in the development of anti-cancer or anti-inflammatory agents, due to the known activities of chalcone derivatives. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C15H12ClNO
InChI:InChI=1S/C15H12ClNO/c16-14-4-2-1-3-11(14)7-10-15(18)12-5-8-13(17)9-6-12/h1-10H,17H2/b10-7+
InChI key:InChIKey=NWJROPBGEICIOP-JXMROGBWSA-N
SMILES:C(/C=C/C1=C(Cl)C=CC=C1)(=O)C2=CC=C(N)C=C2
Synonyms:- (E)-2-Chloro-4′-aminochalcone
- 2-Propen-1-one, 1-(4-aminophenyl)-3-(2-chlorophenyl)-, (2E)-
- (E)-1-(4-Aminophenyl)-3-(2-chlorophenyl)-2-propen-1-one
- (2E)-1-(4-Aminophenyl)-3-(2-chlorophenyl)-2-propen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.