CAS 95262-01-4

3-[(4-Methylphenyl)amino]-3-oxopropanoic acid

Description:

3-[(4-Methylphenyl)amino]-3-oxopropanoic acid, with the CAS number 95262-01-4, is an organic compound characterized by its structure, which includes an amino group, a ketone, and a carboxylic acid functional group. This compound features a propanoic acid backbone with a 4-methylphenyl group attached to the nitrogen of the amino group, contributing to its aromatic character. The presence of the ketone group indicates that it can participate in various chemical reactions, such as nucleophilic addition or condensation. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic ring may enhance its lipophilicity. Its potential applications could span across pharmaceuticals, where it may serve as an intermediate in the synthesis of biologically active molecules. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, would depend on its specific molecular interactions and the environment in which it is used.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1/C10H11NO3/c1-7-2-4-8(5-3-7)11-9(12)6-10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14)

InChI key: InChIKey=BMKFYQZTVRBBDO-UHFFFAOYSA-N

SMILES: N(C(CC(O)=O)=O)C1=CC=C(C)C=C1

Synonyms:

• 2-[(4-Methylphenyl)carbamoyl]acetic acid
• Malonanilic acid, 4′-methyl-
• Propanoic acid, 3-[(4-methylphenyl)amino]-3-oxo-
• 3-[(4-Methylphenyl)amino]-3-oxopropanoic acid

3-[(4-Methylphenyl)amino]-3-oxopropanoic acid

CAS: 95262-01-4

Formula: C₁₀H₁₁NO₃

Purity: 95.0%

Molecular weight: 193.202

Ref: 10-F038977