CAS 95262-02-5

3-[(2,3-Dimethylphenyl)amino]-3-oxopropanoic acid

Description:

3-[(2,3-Dimethylphenyl)amino]-3-oxopropanoic acid, with the CAS number 95262-02-5, is an organic compound characterized by its structure, which includes an amino group and a ketone functional group. This compound features a propanoic acid backbone, where the carbon chain is substituted with a 2,3-dimethylphenyl group, contributing to its aromatic properties. The presence of the amino group indicates potential for hydrogen bonding, which can influence its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests that it may participate in various chemical reactions, including acylation and amination. Additionally, its properties such as melting point, boiling point, and solubility in different solvents would depend on the specific interactions of its functional groups. Overall, this compound's unique structure and functional groups make it a subject of interest in organic chemistry and medicinal chemistry.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1S/C11H13NO3/c1-7-4-3-5-9(8(7)2)12-10(13)6-11(14)15/h3-5H,6H2,1-2H3,(H,12,13)(H,14,15)

InChI key: InChIKey=HGZCCNRSTVUMIA-UHFFFAOYSA-N

SMILES: N(C(CC(O)=O)=O)C1=C(C)C(C)=CC=C1

Synonyms:

• 2-[(2,3-Dimethylphenyl)carbamoyl]acetic acid
• Propanoic acid, 3-[(2,3-dimethylphenyl)amino]-3-oxo-
• 3-[(2,3-Dimethylphenyl)amino]-3-oxopropanoic acid

3-[(2,3-Dimethylphenyl)amino]-3-oxopropanoic acid

CAS: 95262-02-5

Formula: C₁₁H₁₃NO₃

Purity: 95.0%

Molecular weight: 207.229

Ref: 10-F039014