CAS 95262-05-8

3-[(3,5-dimethylphenyl)amino]-3-oxopropanoic acid

Description:

3-[(3,5-Dimethylphenyl)amino]-3-oxopropanoic acid, identified by its CAS number 95262-05-8, is an organic compound characterized by the presence of an amino group and a ketone functional group within its structure. This compound features a propanoic acid backbone, which contributes to its acidic properties. The presence of the 3,5-dimethylphenyl group enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity in various solvents. The amino group can participate in hydrogen bonding, affecting the compound's interactions with other molecules. This substance may exhibit biological activity, making it of interest in pharmaceutical research and development. Its structural features suggest potential applications in medicinal chemistry, particularly in the design of compounds targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and potential toxicity would depend on environmental conditions and the presence of other chemical species. Proper handling and safety measures should be observed when working with this compound in a laboratory setting.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1/C11H13NO3/c1-7-3-8(2)5-9(4-7)12-10(13)6-11(14)15/h3-5H,6H2,1-2H3,(H,12,13)(H,14,15)

SMILES: Cc1cc(C)cc(c1)N=C(CC(=O)O)O

Synonyms:

• Propanoic Acid, 3-[(3,5-Dimethylphenyl)Amino]-3-Oxo-

3-[(3,5-dimethylphenyl)amino]-3-oxopropanoic acid

CAS: 95262-05-8

Formula: C₁₁H₁₃NO₃

Purity: 95.0%

Molecular weight: 207.229

Ref: 10-F310163