CAS 952651-47-7

7-Quinolinesulfonamide

Description:

7-Quinolinesulfonamide is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. This compound features a sulfonamide functional group, which is known for its biological activity and potential pharmaceutical applications. Typically, sulfonamides exhibit antibacterial properties, and the incorporation of the quinoline moiety may enhance their efficacy against various pathogens. The compound is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the sulfonamide group. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, 7-Quinolinesulfonamide may undergo various chemical reactions, including sulfonation and substitution, which can be exploited for further derivatization and optimization in drug development. As with many sulfonamides, safety and toxicity profiles should be evaluated in the context of its intended use, particularly in pharmaceutical applications.

Formula: C₉H₈N₂O₂S

InChI: InChI=1S/C9H8N2O2S/c10-14(12,13)8-4-3-7-2-1-5-11-9(7)6-8/h1-6H,(H2,10,12,13)

InChI key: InChIKey=SHHNAJHUBYXDQP-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC2=C(C=C1)C=CC=N2

Synonyms:

• 7-Quinolinesulfonamide