CAS 952664-51-6

6-Fluoro-1,3-benzodioxole-5-methanol

Description:

6-Fluoro-1,3-benzodioxole-5-methanol is a chemical compound characterized by its unique structure, which includes a benzodioxole moiety and a methanol group. The presence of the fluorine atom at the 6-position of the benzodioxole ring contributes to its chemical reactivity and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications. The methanol group can participate in hydrogen bonding, influencing its solubility and reactivity. Due to its structural features, 6-Fluoro-1,3-benzodioxole-5-methanol may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use. Further studies are often required to fully understand its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₈H₇FO₃

InChI: InChI=1S/C8H7FO3/c9-6-2-8-7(11-4-12-8)1-5(6)3-10/h1-2,10H,3-4H2

InChI key: InChIKey=OOKJYFVPBPNDNF-UHFFFAOYSA-N

SMILES: C(O)C=1C=C2C(=CC1F)OCO2

Synonyms:

• (6-Fluorobenzodioxol-5-yl)methanol
• 1,3-Benzodioxole-5-methanol, 6-fluoro-
• 6-Fluoro-1,3-benzodioxole-5-methanol
• (6-Fluoro-2H-1,3-benzodioxol-5-yl)methanol