CAS 952664-69-6

2-Bromo-5-fluoro-4-nitrobenzenamine

Description:

2-Bromo-5-fluoro-4-nitrobenzenamine is an organic compound characterized by the presence of a bromine atom, a fluorine atom, and a nitro group attached to a benzene ring that also contains an amine functional group. This compound is part of the aniline family, where the amino group (-NH2) is directly bonded to the aromatic ring. The presence of the bromine and fluorine substituents introduces unique electronic and steric properties, which can influence its reactivity and interactions in chemical reactions. The nitro group (-NO2) is a strong electron-withdrawing group, which can enhance the electrophilicity of the aromatic ring, making it more reactive towards nucleophilic substitution reactions. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, due to the polar nature of the nitro and amine groups. Its applications may include use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development. Safety data should be consulted for handling and usage due to potential toxicity associated with nitro compounds.

Formula: C₆H₄BrFN₂O₂

InChI: InChI=1S/C6H4BrFN2O2/c7-3-1-6(10(11)12)4(8)2-5(3)9/h1-2H,9H2

InChI key: InChIKey=PKDUOURYTVRBLI-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(F)C=C(N)C(Br)=C1

Synonyms:

• 2-Bromo-5-fluoro-4-nitroaniline
• Benzenamine, 2-bromo-5-fluoro-4-nitro-
• 2-Bromo-5-fluoro-4-nitro-phenylamine
• 2-Bromo-5-fluoro-4-nitrobenzenamine
• BenzenaMine, 2-broMo-5-fluoro-4-nitro-2

2-Bromo-5-fluoro-4-nitroaniline

CAS: 952664-69-6

Formula: C₆H₄BrFN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 235.0106

Ref: IN-DA00IIWN

2-Bromo-5-fluoro-4-nitroaniline

CAS: 952664-69-6

2-Bromo-5-fluoro-4-nitroaniline

Purity: 98%

Molecular weight: 235.01g/mol

Ref: 54-PC500296

2-Bromo-5-fluoro-4-nitroaniline

CAS: 952664-69-6

Formula: C₆H₄BrFN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 235.012

Ref: 10-F323333

2-Bromo-5-fluoro-4-nitroaniline

CAS: 952664-69-6

2-Bromo-5-fluoro-4-nitroaniline can be synthesized in a reaction system of ammonium chloride, hydrochloric acid, and water vapor. The reaction is carried out at a temperature of 190°C under reflux. The efficiency of this synthesis is high, and the chemical yield is about 90%.

Formula: C₆H₄BrFN₂O₂

Purity: Min. 95%

Molecular weight: 235.01 g/mol

Ref: 3D-CNB66469