
CAS 952664-73-2
:2-(1,1-Dimethylethyl)-6-fluoro-1H-indol-5-amine
Description:
2-(1,1-Dimethylethyl)-6-fluoro-1H-indol-5-amine, identified by its CAS number 952664-73-2, is a chemical compound that belongs to the indole class of compounds, which are characterized by a fused benzene and pyrrole ring structure. This particular compound features a fluoro substituent at the 6-position and a bulky tert-butyl group at the 2-position of the indole ring, which can influence its steric and electronic properties. The presence of an amine group at the 5-position contributes to its potential reactivity and solubility in various solvents. Compounds of this nature are often studied for their biological activity, including potential applications in pharmaceuticals, due to their ability to interact with biological targets. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's molecular structure and the conditions under which they are measured. Overall, this compound's unique structure may confer specific properties that are of interest in medicinal chemistry and drug development.
Formula:C12H15FN2
InChI:InChI=1S/C12H15FN2/c1-12(2,3)11-5-7-4-9(14)8(13)6-10(7)15-11/h4-6,15H,14H2,1-3H3
InChI key:InChIKey=UMFPJGRFCBFPOK-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC=2C(N1)=CC(F)=C(N)C2
Synonyms:- 2-(1,1-Dimethylethyl)-6-fluoro-1H-indol-5-amine
- 2-tert-Butyl-6-fluoro-1H-indol-5-amine
- 1H-Indol-5-amine, 2-(1,1-dimethylethyl)-6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.