CAS 952674-79-2

N-Ethyl-1H-pyrrole-3-carboxamide

Description:

N-Ethyl-1H-pyrrole-3-carboxamide is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features an ethyl group attached to the nitrogen atom of the pyrrole, as well as a carboxamide functional group at the 3-position of the ring. The presence of the carboxamide group contributes to its potential as a polar molecule, influencing its solubility in various solvents. N-Ethyl-1H-pyrrole-3-carboxamide may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could be explored in pharmacological studies. Additionally, the compound's stability and reactivity can be influenced by the electronic properties of the pyrrole ring and the substituents attached to it. Overall, N-Ethyl-1H-pyrrole-3-carboxamide represents a class of compounds that may have diverse applications in research and industry, particularly in the fields of organic synthesis and pharmaceuticals.

Formula: C₇H₁₀N₂O

InChI: InChI=1S/C7H10N2O/c1-2-9-7(10)6-3-4-8-5-6/h3-5,8H,2H2,1H3,(H,9,10)

InChI key: InChIKey=XOJPDEBNBIFJQS-UHFFFAOYSA-N

SMILES: C(NCC)(=O)C=1C=CNC1

Synonyms:

• 1H-Pyrrole-3-carboxamide, N-ethyl-
• N-Ethyl-1H-pyrrole-3-carboxamide