CAS 952675-93-3
:5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydronaphthalene-2-carbonitrile
Description:
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,8-dihydronaphthalene-2-carbonitrile is a chemical compound characterized by its complex structure, which includes a naphthalene moiety and a dioxaborolane group. The presence of the carbonitrile functional group indicates that it has a cyano (-C≡N) substituent, which can impart significant reactivity and polarity to the molecule. The dioxaborolane unit contributes to its potential applications in organic synthesis and materials science, particularly in the formation of boron-containing compounds. This compound may exhibit interesting electronic properties due to the conjugation between the naphthalene and the cyano group, making it a candidate for use in organic electronics or as a building block in the synthesis of more complex molecules. Additionally, the tetramethyl substitution on the dioxaborolane enhances its stability and solubility in organic solvents. Overall, this compound's unique structural features suggest potential utility in various chemical applications, including medicinal chemistry and materials development.
Formula:C17H20BNO2
InChI:InChI=1/C17H20BNO2/c1-16(2)17(3,4)21-18(20-16)15-7-5-6-13-10-12(11-19)8-9-14(13)15/h7-10H,5-6H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(C2=CCCc3cc(ccc23)C#N)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-7,8-dihydronaphthalene-2-carbonitrile
CAS:Formula:C17H20BNO2Molecular weight:281.15725-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-7,8-dihydronaphthalene-2-carbonitrile
CAS:Controlled ProductFormula:C17H20BNO2Color and Shape:NeatMolecular weight:281.16

