
CAS 95270-88-5
:Polyfluorene
Description:
Polyfluorene is a conjugated polymer characterized by its repeating units of fluorene, which is a bicyclic aromatic compound. This polymer exhibits unique optical and electronic properties, making it suitable for applications in organic light-emitting diodes (OLEDs), organic photovoltaics, and other optoelectronic devices. Polyfluorene typically displays strong photoluminescence, with emission colors that can range from blue to green, depending on its molecular weight and the presence of side chains. Its structure allows for efficient charge transport, which is crucial for its performance in electronic applications. Additionally, polyfluorene is known for its thermal stability and mechanical flexibility, which are advantageous for various processing techniques. However, it can be sensitive to environmental factors such as oxygen and moisture, which may affect its performance and longevity. Overall, polyfluorene is a significant material in the field of organic electronics due to its favorable properties and versatility in device fabrication.
Formula:(C13H10)x
InChI:InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2
InChI key:InChIKey=NIHNNTQXNPWCJQ-UHFFFAOYSA-N
SMILES:C1=2C=3C(CC1=CC=CC2)=CC=CC3
Synonyms:- Fluorene polymer
- 9H-Fluorene, homopolymer
- Fluorene homopolymer
- Polyfluorene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
