CAS 95282-55-6

(4-butylphenyl)(4-tert-butylphenyl)methanone

Description:

(4-butylphenyl)(4-tert-butylphenyl)methanone, with CAS number 95282-55-6, is an organic compound characterized by its ketone functional group, specifically a methanone structure where two bulky aryl groups are attached. This compound features a butyl group and a tert-butyl group on the phenyl rings, contributing to its steric hindrance and potentially influencing its physical properties, such as solubility and melting point. The presence of these bulky substituents may also affect its reactivity and interactions with other molecules. Typically, compounds of this nature are studied for their applications in materials science, particularly in the development of photoinitiators or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit interesting optical properties, making it suitable for use in various chemical applications, including coatings and polymers. Additionally, the stability and behavior of this compound under different conditions would be of interest in both academic and industrial research settings.

Formula: C₂₁H₂₆O

InChI: InChI=1/C21H26O/c1-5-6-7-16-8-10-17(11-9-16)20(22)18-12-14-19(15-13-18)21(2,3)4/h8-15H,5-7H2,1-4H3

SMILES: CCCCc1ccc(cc1)C(=O)c1ccc(cc1)C(C)(C)C

Synonyms:

• Methanone, (4-butylphenyl)[4-(1,1-dimethylethyl)phenyl]-