CAS 952934-82-6
:Methyl 1-(2-furanylcarbonyl)-4-piperidineacetate
Description:
Methyl 1-(2-furanylcarbonyl)-4-piperidineacetate, identified by its CAS number 952934-82-6, is a chemical compound characterized by its unique structure that includes a piperidine ring and a furan moiety. This compound typically exhibits properties associated with both the piperidine and furan functional groups, which may influence its solubility, reactivity, and potential biological activity. The presence of the ester functional group (acetate) suggests that it may participate in esterification or hydrolysis reactions. Methyl 1-(2-furanylcarbonyl)-4-piperidineacetate may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise characterization. Overall, this compound represents a blend of structural features that could lead to diverse chemical behavior and applications.
Formula:C13H17NO4
InChI:InChI=1S/C13H17NO4/c1-17-12(15)9-10-4-6-14(7-5-10)13(16)11-3-2-8-18-11/h2-3,8,10H,4-7,9H2,1H3
InChI key:InChIKey=TWBMZGYYTRXQJL-UHFFFAOYSA-N
SMILES:C(=O)(N1CCC(CC(OC)=O)CC1)C2=CC=CO2
Synonyms:- Methyl 1-(2-furanylcarbonyl)-4-piperidineacetate
- [1-(Furan-2-carbonyl)-piperidin-4-yl]-acetic acid methyl ester
- 4-Piperidineacetic acid, 1-(2-furanylcarbonyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.