CAS 952948-94-6

3-Bromo-5-chloro-6-methyl-2-pyridinamine

Description:

3-Bromo-5-chloro-6-methyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of bromine and chlorine substituents at the 3 and 5 positions, respectively, along with a methyl group at the 6 position, contributes to its unique chemical properties. This compound is likely to exhibit moderate to high polarity due to the electronegative halogen atoms, which can influence its solubility in various solvents. The amino group (-NH2) at the 2 position enhances its reactivity, making it a potential candidate for further chemical modifications or as an intermediate in synthetic pathways. Additionally, the presence of multiple halogens may impart biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as a building block in the synthesis of more complex organic molecules. Safety and handling precautions should be observed due to the presence of halogenated compounds, which can pose environmental and health risks.

Formula: C₆H₆BrClN₂

InChI: InChI=1S/C6H6BrClN2/c1-3-5(8)2-4(7)6(9)10-3/h2H,1H3,(H2,9,10)

SMILES: Cc1c(cc(c(=N)[nH]1)Br)Cl

6-Amino-5-bromo-3-chloropicoline

CAS: 952948-94-6

Formula: C₆H₆BrClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 221.4822

Ref: IN-DA00IIX4

3-Bromo-5-chloro-6-methylpyridin-2-amine

CAS: 952948-94-6

3-Bromo-5-chloro-6-methylpyridin-2-amine

Purity: 98%

Molecular weight: 221.48g/mol

Ref: 54-OR82451

3-Bromo-5-chloro-6-methylpyridin-2-amine

CAS: 952948-94-6

Purity: 98%

Molecular weight: 221.4799957

Ref: 10-F610669