CAS 952949-14-3
:1-(2-Nitrophenyl)-4-piperidinamine
Description:
1-(2-Nitrophenyl)-4-piperidinamine, identified by its CAS number 952949-14-3, is an organic compound characterized by the presence of a piperidine ring substituted with a nitrophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in polar solvents due to the presence of the amino group. The nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and interaction with biological systems. As a piperidinamine derivative, it may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's structure suggests potential applications in drug development, particularly in the synthesis of compounds targeting specific biological pathways. Safety and handling precautions should be observed, as nitro compounds can be sensitive and may pose health risks. Overall, 1-(2-Nitrophenyl)-4-piperidinamine represents a class of compounds that bridge organic synthesis and biological activity, warranting further investigation for its potential applications.
Formula:C11H15N3O2
InChI:InChI=1S/C11H15N3O2/c12-9-5-7-13(8-6-9)10-3-1-2-4-11(10)14(15)16/h1-4,9H,5-8,12H2
InChI key:InChIKey=RRZHTNIPNNRZFW-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC=C1)N2CCC(N)CC2
Synonyms:- 1-(2-Nitrophenyl)-4-piperidinamine
- 4-Piperidinamine, 1-(2-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
