CAS 952958-69-9

1-(3-Chloro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid

Description:

1-(3-Chloro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a carboxylic acid group and a chloromethylphenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid functional group. The chloromethylphenyl group can influence its solubility and polarity, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the chlorine atom may also impart specific biological activities or enhance interactions with biological targets. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or coupling reactions, which are common in organic synthesis. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and material science, although specific applications would depend on further research and development.

Formula: C₁₂H₁₀ClNO₂

InChI: InChI=1S/C12H10ClNO2/c1-8-4-5-9(7-10(8)13)14-6-2-3-11(14)12(15)16/h2-7H,1H3,(H,15,16)

InChI key: InChIKey=FSUNTYKNFADKJY-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N(C=CC1)C2=CC(Cl)=C(C)C=C2

Synonyms:

• 1H-Pyrrole-2-carboxylic acid, 1-(3-chloro-4-methylphenyl)-
• 1-(3-Chloro-4-methylphenyl)-1H-pyrrole-2-carboxylic acid