CAS 952958-70-2
:4-(2,5-Dimethylphenyl)-2-thiazolecarboxylic acid
Description:
4-(2,5-Dimethylphenyl)-2-thiazolecarboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the 2,5-dimethylphenyl group enhances its hydrophobic characteristics and may influence its solubility and reactivity. Typically, compounds like this can exhibit biological activity, making them of interest in pharmaceutical research. The thiazole moiety is often associated with various biological activities, including antimicrobial and anti-inflammatory properties. Additionally, the compound's structure suggests potential applications in organic synthesis and material science. Its CAS number, 952958-70-2, allows for easy identification and reference in chemical databases. Overall, the unique combination of functional groups and structural features makes 4-(2,5-Dimethylphenyl)-2-thiazolecarboxylic acid a compound of interest in both academic and industrial chemistry contexts.
Formula:C12H11NO2S
InChI:InChI=1S/C12H11NO2S/c1-7-3-4-8(2)9(5-7)10-6-16-11(13-10)12(14)15/h3-6H,1-2H3,(H,14,15)
InChI key:InChIKey=ONTNYTCJEFPHSY-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C)C=C1)C=2N=C(C(O)=O)SC2
Synonyms:- 4-(2,5-Dimethylphenyl)-2-thiazolecarboxylic acid
- 2-Thiazolecarboxylic acid, 4-(2,5-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.