CAS 952959-38-5
:4-(3,4-Dichlorophenyl)-2-thiazolecarboxylic acid
Description:
4-(3,4-Dichlorophenyl)-2-thiazolecarboxylic acid is a chemical compound characterized by its thiazole and carboxylic acid functional groups. It features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, and a dichlorophenyl substituent that enhances its biological activity. The presence of the carboxylic acid group (-COOH) contributes to its acidity and potential for forming salts or esters. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit antimicrobial or anti-inflammatory activities. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in drug development. Additionally, the dichlorophenyl moiety can influence the compound's lipophilicity and solubility, affecting its bioavailability. Safety and handling precautions should be observed due to the presence of chlorine atoms, which can pose environmental and health risks. Overall, 4-(3,4-Dichlorophenyl)-2-thiazolecarboxylic acid is a significant compound in the realm of chemical research and pharmaceutical applications.
Formula:C10H5Cl2NO2S
InChI:InChI=1S/C10H5Cl2NO2S/c11-6-2-1-5(3-7(6)12)8-4-16-9(13-8)10(14)15/h1-4H,(H,14,15)
InChI key:InChIKey=DPLDBZKECUWDOR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=NC(=CS1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- 2-Thiazolecarboxylic acid, 4-(3,4-dichlorophenyl)-
- 4-(3,4-Dichlorophenyl)-2-thiazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
