CAS 952959-40-9
:2-(4-Methoxy-3,5-dimethylphenyl)imidazo[1,2-a]pyridine
Description:
2-(4-Methoxy-3,5-dimethylphenyl)imidazo[1,2-a]pyridine is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core fused with a substituted phenyl group. The presence of a methoxy group and two methyl groups on the phenyl ring contributes to its unique electronic and steric properties, potentially influencing its reactivity and solubility. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic components, which may affect its bioavailability and interaction with biological systems. Additionally, the imidazo[1,2-a]pyridine moiety is known for its pharmacological relevance, often associated with various biological activities, including potential anti-cancer and anti-inflammatory properties. The specific arrangement of substituents can also impact the compound's ability to interact with specific receptors or enzymes, making it of interest in medicinal chemistry. Overall, this compound's characteristics suggest it may have applications in drug development and research, although further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C16H16N2O
InChI:InChI=1S/C16H16N2O/c1-11-8-13(9-12(2)16(11)19-3)14-10-18-7-5-4-6-15(18)17-14/h4-10H,1-3H3
InChI key:InChIKey=NZARPCUXAHQSLU-UHFFFAOYSA-N
SMILES:CC=1C=C(C2=CN3C(=N2)C=CC=C3)C=C(C)C1OC
Synonyms:- Imidazo[1,2-a]pyridine, 2-(4-methoxy-3,5-dimethylphenyl)-
- 2-(4-Methoxy-3,5-dimethylphenyl)imidazo[1,2-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.