CAS 952959-47-6

2-(Acetylamino)-5-ethylbenzenesulfonyl chloride

Description:

2-(Acetylamino)-5-ethylbenzenesulfonyl chloride, with the CAS number 952959-47-6, is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features an acetylamino group, contributing to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the ethyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. As a sulfonyl chloride, it is typically used as a reagent in various chemical reactions, including acylation and the formation of sulfonamides. The compound is likely to be a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and storage. Its reactivity with nucleophiles makes it valuable in synthetic organic chemistry, while its specific applications would depend on the functionalization of the sulfonyl chloride group in various chemical transformations.

Formula: C₁₀H₁₂ClNO₃S

InChI: InChI=1S/C10H12ClNO3S/c1-3-8-4-5-9(12-7(2)13)10(6-8)16(11,14)15/h4-6H,3H2,1-2H3,(H,12,13)

InChI key: InChIKey=KUXZLAXOUBDPOK-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(NC(C)=O)C=CC(CC)=C1

Synonyms:

• 2-(Acetylamino)-5-ethylbenzenesulfonyl chloride
• Benzenesulfonyl chloride, 2-(acetylamino)-5-ethyl-