CAS 952959-52-3
:4-(2-Aminoethyl)-5-(2-furanyl)-1,2-dihydro-3H-pyrazol-3-one
Description:
4-(2-Aminoethyl)-5-(2-furanyl)-1,2-dihydro-3H-pyrazol-3-one is a chemical compound characterized by its unique structure, which includes a pyrazolone core substituted with a furanyl group and an aminoethyl side chain. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The furanyl moiety contributes to its potential reactivity and may influence its electronic properties, making it of interest in various chemical applications, including medicinal chemistry. The presence of the pyrazolone structure suggests potential biological activity, as many pyrazolone derivatives are known for their analgesic and anti-inflammatory properties. Additionally, the compound may undergo various chemical reactions, such as oxidation or substitution, depending on the conditions. Overall, 4-(2-Aminoethyl)-5-(2-furanyl)-1,2-dihydro-3H-pyrazol-3-one represents a versatile scaffold for further chemical exploration and development in pharmaceutical research.
Formula:C9H11N3O2
InChI:InChI=1S/C9H11N3O2/c10-4-3-6-8(11-12-9(6)13)7-2-1-5-14-7/h1-2,5H,3-4,10H2,(H2,11,12,13)
InChI key:InChIKey=HTBBBMYUXHGUSH-UHFFFAOYSA-N
SMILES:C(CN)C1=C(NNC1=O)C2=CC=CO2
Synonyms:- 3H-Pyrazol-3-one, 4-(2-aminoethyl)-5-(2-furanyl)-1,2-dihydro-
- 4-(2-Aminoethyl)-5-(2-furanyl)-1,2-dihydro-3H-pyrazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.