CAS 952959-65-8

5-(2-Pyrrolidinyl)-1,3,4-thiadiazol-2-amine

Description:

5-(2-Pyrrolidinyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a pyrrolidine moiety. The thiadiazole ring is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms, contributing to the compound's potential biological activity. The presence of the pyrrolidine group, a saturated five-membered ring containing nitrogen, may influence the compound's solubility and interaction with biological targets. This compound is often studied for its potential pharmacological properties, including antimicrobial and anti-inflammatory activities. Its molecular structure allows for various modifications, which can enhance its efficacy or selectivity in biological applications. The CAS number 952959-65-8 serves as a unique identifier for this substance, facilitating its recognition in scientific literature and databases. As with many heterocyclic compounds, the specific properties such as melting point, boiling point, and solubility can vary based on the conditions and the presence of other functional groups.

Formula: C₆H₁₀N₄S

InChI: InChI=1S/C6H10N4S/c7-6-10-9-5(11-6)4-2-1-3-8-4/h4,8H,1-3H2,(H2,7,10)

InChI key: InChIKey=ADKPDJODVUTEIT-UHFFFAOYSA-N

SMILES: NC=1SC(=NN1)C2CCCN2

Synonyms:

• 1,3,4-Thiadiazol-2-amine, 5-(2-pyrrolidinyl)-
• 5-(2-Pyrrolidinyl)-1,3,4-thiadiazol-2-amine