CAS 953-79-7
:4-(Methylamino)-1-(phenylmethyl)-4-piperidinecarbonitrile
Description:
4-(Methylamino)-1-(phenylmethyl)-4-piperidinecarbonitrile, with the CAS number 953-79-7, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a methylamino group and a phenylmethyl group, as well as a cyano group (–C≡N) at the carbon adjacent to the nitrogen. The presence of the methylamino group suggests potential basic properties, while the phenylmethyl moiety can contribute to its lipophilicity and ability to interact with biological targets. The cyano group may impart reactivity and influence the compound's overall stability. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications. However, specific details regarding its solubility, melting point, and other physical properties would require empirical data. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C14H19N3
InChI:InChI=1/C14H19N3/c1-16-14(12-15)7-9-17(10-8-14)11-13-5-3-2-4-6-13/h2-6,16H,7-11H2,1H3
InChI key:InChIKey=NVTHHBZDNKNEDB-UHFFFAOYSA-N
SMILES:C(#N)C1(NC)CCN(CC2=CC=CC=C2)CC1
Synonyms:- 1-Benzyl-4-(methylamino)piperidine-4-carbonitrile
- 4-Piperidinecarbonitrile, 4-(methylamino)-1-(phenylmethyl)-
- NSC 664997
- Isonipecotonitrile, 1-benzyl-4-(methylamino)-
- NSC 72993
- 4-(Methylamino)-1-(phenylmethyl)-4-piperidinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
