CAS 953039-62-8

8-Bromo-6-fluoro-2(1H)-quinazolinone

Description:

8-Bromo-6-fluoro-2(1H)-quinazolinone is a synthetic organic compound characterized by its quinazolinone core structure, which is a bicyclic compound featuring a fused benzene and pyrimidine ring. The presence of bromine and fluorine substituents at the 8 and 6 positions, respectively, enhances its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for halogenated heterocycles. It may display interesting pharmacological properties, making it a subject of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The compound's structure allows for potential interactions with biological targets, and its halogen substituents can influence its lipophilicity and metabolic stability. As with many quinazolinone derivatives, it may also exhibit fluorescence, which can be useful in various analytical applications. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.

Formula: C₈H₄BrFN₂O

InChI: InChI=1S/C8H4BrFN2O/c9-6-2-5(10)1-4-3-11-8(13)12-7(4)6/h1-3H,(H,11,12,13)

InChI key: InChIKey=IZLVJYKIZZWDPX-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CC(F)=C1)C=NC(=O)N2

Synonyms:

• 8-Bromo-6-fluoro-2(1H)-quinazolinone
• 2(1H)-Quinazolinone, 8-bromo-6-fluoro-
• 8-bromo-6-fluoro-1,2-dihydroquinazolin-2-one
• 8-Bromo-6-fluoroquinazolin-2(1H)-one