CAS 953072-18-9

N-(3-methylbenzyl)ethane-1,2-diamine

Description:

N-(3-methylbenzyl)ethane-1,2-diamine is an organic compound characterized by its amine functional groups and a substituted aromatic ring. It features a two-carbon ethane backbone with amino groups (-NH2) at the first and second positions, and a 3-methylbenzyl group attached to the nitrogen atom. This structure imparts both hydrophilic and hydrophobic characteristics, making it potentially useful in various applications, including pharmaceuticals and materials science. The presence of the aromatic ring contributes to its stability and may influence its reactivity and interaction with other molecules. As a diamine, it can participate in various chemical reactions, such as forming polyamides or serving as a building block in organic synthesis. The compound's physical properties, such as solubility, melting point, and boiling point, would depend on its molecular interactions and the presence of functional groups. Safety data should be consulted for handling and usage, as amines can be hazardous in certain contexts.

Formula: C₁₀H₁₆N₂

InChI: InChI=1/C10H16N2/c1-9-3-2-4-10(7-9)8-12-6-5-11/h2-4,7,12H,5-6,8,11H2,1H3

SMILES: Cc1cccc(c1)CNCCN

Synonyms:

• 1,2-ethanediamine, N< sup> 1< /sup> -[(3-methylphenyl)methyl]-