CAS 953072-23-6
:N1-[(3-Fluorophenyl)methyl]-1,3-propanediamine
Description:
N1-[(3-Fluorophenyl)methyl]-1,3-propanediamine, identified by its CAS number 953072-23-6, is an organic compound characterized by its structure, which includes a propanediamine backbone substituted with a 3-fluorobenzyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the fluorine atom in the aromatic ring can enhance lipophilicity and may affect the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit moderate to high reactivity due to the amine functional groups, which can participate in various chemical reactions, including alkylation and acylation. Its potential applications could span across pharmaceuticals, particularly in the development of therapeutic agents targeting specific biological pathways. As with many amines, safety considerations regarding handling and exposure should be observed, given their potential for toxicity and reactivity.
Formula:C10H15FN2
InChI:InChI=1S/C10H15FN2/c11-10-4-1-3-9(7-10)8-13-6-2-5-12/h1,3-4,7,13H,2,5-6,8,12H2
InChI key:InChIKey=QASVZHQJTWLVLZ-UHFFFAOYSA-N
SMILES:C(NCCCN)C1=CC(F)=CC=C1
Synonyms:- 1,3-Propanediamine, N1-[(3-fluorophenyl)methyl]-
- N1-[(3-Fluorophenyl)methyl]-1,3-propanediamine
- (3-Aminopropyl)[(3-fluorophenyl)methyl]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.