CAS 953077-10-6

Cyclopentyl-1H-imidazol-1-ylmethanone

Description:

Cyclopentyl-1H-imidazol-1-ylmethanone is a chemical compound characterized by its unique structure, which includes a cyclopentyl group and an imidazole ring. The imidazole moiety contributes to its potential biological activity, as imidazole derivatives are often found in pharmaceuticals and agrochemicals. This compound typically exhibits moderate to high solubility in organic solvents, which can facilitate its use in various chemical reactions and applications. Its molecular structure suggests that it may participate in hydrogen bonding due to the presence of nitrogen atoms in the imidazole ring, potentially influencing its reactivity and interaction with other molecules. Additionally, the presence of the cyclopentyl group may impart specific steric and electronic properties, affecting the compound's overall stability and reactivity. While specific physical properties such as melting point, boiling point, and density are not provided, compounds of this nature often exhibit interesting pharmacological profiles, making them subjects of interest in medicinal chemistry and drug development.

Formula: C₉H₁₂N₂O

InChI: InChI=1S/C9H12N2O/c12-9(8-3-1-2-4-8)11-6-5-10-7-11/h5-8H,1-4H2

InChI key: InChIKey=BZHPGRUJLDABQI-UHFFFAOYSA-N

SMILES: C(=O)(C1CCCC1)N2C=CN=C2

Synonyms:

• Methanone, cyclopentyl-1H-imidazol-1-yl-
• 1-Cyclopentanecarbonyl-1H-imidazole
• Cyclopentyl-1H-imidazol-1-ylmethanone