CAS 95326-10-6

3-nitroso-1,3-oxazolidine-4-carboxylic acid

Description:

3-Nitroso-1,3-oxazolidine-4-carboxylic acid is a heterocyclic organic compound characterized by its oxazolidine ring structure, which incorporates a nitroso group and a carboxylic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents due to the presence of the carboxylic acid group. The nitroso group contributes to its reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophiles. The oxazolidine ring provides stability and can influence the compound's biological activity, potentially making it relevant in medicinal chemistry. Its unique structure allows for interactions with biological systems, which may lead to applications in pharmaceuticals or agrochemicals. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization. Safety data should also be consulted, as compounds with nitroso groups can sometimes be associated with toxicity or hazardous properties.

Formula: C₄H₆N₂O₄

InChI: InChI=1/C4H6N2O4/c7-4(8)3-1-10-2-6(3)5-9/h3H,1-2H2,(H,7,8)

SMILES: C1C(C(=O)O)N(CO1)N=O

3-Nitroso-4-oxazolidinecarboxyli​c Acid

Controlled Product

CAS: 95326-10-6

Formula: C₄H₆N₂O₄

Color and Shape: Neat

Molecular weight: 146.1

Ref: TR-N540000