CymitQuimica logo

CAS 95326-11-7

:

5-methyl-3-nitroso-1,3-oxazolidine-4-carboxylic acid

Description:
5-Methyl-3-nitroso-1,3-oxazolidine-4-carboxylic acid is a heterocyclic organic compound characterized by its oxazolidine ring structure, which incorporates a nitroso group and a carboxylic acid functional group. This compound typically exhibits properties associated with both its cyclic structure and the presence of functional groups, such as potential acidity due to the carboxylic acid and reactivity due to the nitroso group. The methyl group contributes to its hydrophobic character, influencing its solubility and interaction with other molecules. The oxazolidine ring can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it of interest in synthetic organic chemistry. Additionally, compounds with similar structures may exhibit biological activity, although specific biological properties of this compound would require further investigation. Overall, 5-methyl-3-nitroso-1,3-oxazolidine-4-carboxylic acid represents a unique structure that may have applications in pharmaceuticals or agrochemicals, depending on its reactivity and biological interactions.
Formula:C5H8N2O4
InChI:InChI=1/C5H8N2O4/c1-3-4(5(8)9)7(6-10)2-11-3/h3-4H,2H2,1H3,(H,8,9)
SMILES:CC1C(C(=O)O)N(CO1)N=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.