CymitQuimica logo

CAS 95333-16-7

:

Ethanone,1-(7-benzofuranyl)-

Description:
Ethanone, 1-(7-benzofuranyl)-, also known by its CAS number 95333-16-7, is an organic compound characterized by the presence of a benzofuran moiety attached to an ethanone functional group. This compound features a carbonyl group (C=O) adjacent to a benzofuran ring, which contributes to its unique chemical properties. Benzofurans are known for their aromaticity and potential biological activity, making this compound of interest in medicinal chemistry. The presence of the ethanone group suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the compound's structure may influence its solubility, stability, and reactivity, which are important factors in its potential applications. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, they can typically be inferred from the compound's structure and related compounds. Overall, Ethanone, 1-(7-benzofuranyl)- represents a class of compounds that may have significant implications in chemical research and development.
Formula:C10H8O2
InChI:InChI=1S/C10H8O2/c1-7(11)9-4-2-3-8-5-6-12-10(8)9/h2-6H,1H3
InChI key:JYBKIRQDEMJQOB-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC=CC2=C1OC=C2
Synonyms:
  • Ethanone, 1-(7-benzofuranyl)- (9CI)
Found 3 products.