
CAS 95333-18-9
:1-(2,2-Dimethoxyethoxy)-2-methylbenzene
Description:
1-(2,2-Dimethoxyethoxy)-2-methylbenzene, also known by its CAS number 95333-18-9, is an organic compound characterized by its aromatic structure, which includes a methyl group and a dimethoxyethoxy substituent. This compound features a benzene ring, which is a stable and common structure in organic chemistry, providing significant stability and reactivity patterns typical of aromatic compounds. The presence of the dimethoxyethoxy group enhances its solubility in organic solvents and may influence its reactivity, making it useful in various chemical applications, including as an intermediate in organic synthesis. The compound is likely to exhibit moderate volatility and may have specific interactions with other chemical species due to the presence of ether functionalities. Its physical properties, such as boiling point and melting point, would depend on the molecular interactions and the overall structure. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H16O3
InChI:InChI=1S/C11H16O3/c1-9-6-4-5-7-10(9)14-8-11(12-2)13-3/h4-7,11H,8H2,1-3H3
InChI key:InChIKey=GSWYMRCRHZVKMH-UHFFFAOYSA-N
SMILES:O(CC(OC)OC)C1=C(C)C=CC=C1
Synonyms:- Benzene, 1-(2,2-dimethoxyethoxy)-2-methyl-
- 1-(2,2-Dimethoxyethoxy)-2-methylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.