CAS 95333-81-6
:1-(3,5-difluorobenzyl)-2,3-dihydro-1H-imidazole
Description:
1-(3,5-Difluorobenzyl)-2,3-dihydro-1H-imidazole is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a difluorobenzyl group at the 1-position of the imidazole ring contributes to its unique properties, including potential biological activity and solubility characteristics. This compound is likely to exhibit moderate polarity due to the fluorine substituents, which can influence its reactivity and interaction with other molecules. The imidazole moiety is known for its role in various biological systems, including as a component of amino acids and pharmaceuticals. Additionally, the difluorobenzyl group may enhance lipophilicity, affecting the compound's pharmacokinetics. The compound's CAS number, 95333-81-6, allows for easy identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, this substance may have potential applications in medicinal chemistry and drug development, warranting further investigation into its biological properties and mechanisms of action.
Formula:C10H10F2N2
InChI:InChI=1/C10H10F2N2/c11-9-3-8(4-10(12)5-9)6-14-2-1-13-7-14/h1-5,13H,6-7H2
SMILES:C1=CN(Cc2cc(cc(c2)F)F)CN1
Synonyms:- 1H-imidazole, 1-[(3,5-difluorophenyl)methyl]-2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.