CymitQuimica logo

CAS 95335-46-9

:

[2-(Chloromethyl)phenyl]acetic acid

Description:
[2-(Chloromethyl)phenyl]acetic acid, with the CAS number 95335-46-9, is an organic compound characterized by its phenylacetic acid structure modified with a chloromethyl group at the ortho position of the phenyl ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic phenyl group. The presence of the chloromethyl group introduces reactivity, making it a potential intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Safety data should be consulted for handling and storage, as chlorinated compounds can pose health risks. Overall, [2-(Chloromethyl)phenyl]acetic acid serves as a valuable building block in synthetic organic chemistry.
Formula:C9H9ClO2
InChI:InChI=1/C9H9ClO2/c10-6-8-4-2-1-3-7(8)5-9(11)12/h1-4H,5-6H2,(H,11,12)
InChI key:RFYCQJHCAPCSTA-UHFFFAOYSA-N
SMILES:c1ccc(CCl)c(c1)CC(=O)O
Synonyms:
  • Benzeneacetic Acid, 2-(Chloromethyl)-
  • 2-(Chloromethyl)phenylaceticacid
  • 2-(Chloromethyl)phenylacetic acid
Found 4 products.