CAS 95335-91-4

D-alpha,beta-cyclohexylidene-glycerol

Description:

D-alpha,beta-cyclohexylidene-glycerol, identified by its CAS number 95335-91-4, is a chemical compound that features a glycerol backbone modified with a cyclohexylidene group. This modification typically enhances the compound's hydrophobic characteristics, making it potentially useful in various applications, including pharmaceuticals and cosmetics. The presence of the cyclohexylidene moiety can influence the compound's solubility, stability, and interaction with biological systems. D-alpha,beta-cyclohexylidene-glycerol may exhibit properties such as being a surfactant or emulsifier, which can be beneficial in formulations requiring improved texture or stability. Additionally, its structural characteristics may allow for specific interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Overall, this compound represents a unique structure that could have diverse applications in various fields of chemistry and material science.

Formula: C₉H₁₆O₃

InChI: InChI=1/C9H16O3/c10-6-8-7-11-9(12-8)4-2-1-3-5-9/h8,10H,1-7H2/t8-/m0/s1

SMILES: C1CCC2(CC1)OC[C@H](CO)O2

Synonyms:

• D-alpha,beta-Cyclohexylideneglycerol
• (+)-1,4-Dioxaspiro(4.5)Decane-2-Methanol
• 1,4-Dioxaspiro[4.5]Dec-2-Ylmethanol
• (2S)-1,4-dioxaspiro[4.5]dec-2-ylmethanol

D-α,β-cyclohexylideneglycerol

CAS: 95335-91-4

Formula: C₉H₁₆O₃

Molecular weight: 172.2215

Ref: IN-DA003PWS

[(3S)-1,4-Dioxaspiro[4.5]decan-3-yl]methanol

CAS: 95335-91-4

[(3S)-1,4-Dioxaspiro[4.5]decan-3-yl]methanol

Purity: 95%

Molecular weight: 172.22g/mol

Ref: 54-OR938463