CymitQuimica logo

CAS 95337-74-9

:

6-butylpyridin-2-amine

Description:
6-Butylpyridin-2-amine, with the CAS number 95337-74-9, is an organic compound characterized by its pyridine ring substituted with a butyl group and an amino group at the 2-position. This compound typically exhibits properties associated with both amines and heterocyclic compounds. It is likely to be a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the amino group suggests that it can participate in hydrogen bonding, which may influence its solubility in polar solvents. Additionally, the butyl group contributes to its hydrophobic characteristics, potentially affecting its overall reactivity and interaction with other substances. 6-Butylpyridin-2-amine may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H14N2
InChI:InChI=1/C9H14N2/c1-2-3-5-8-6-4-7-9(10)11-8/h4,6-7H,2-3,5H2,1H3,(H2,10,11)
InChI key:DYUWACXYDOBYEN-UHFFFAOYSA-N
SMILES:CCCCc1cccc(N)n1
Found 4 products.