CAS 953390-31-3

(~13~C_6_)benzene-1,3-diol

Description:

The chemical substance known as (~13~C_6_)benzene-1,3-diol, with the CAS number 953390-31-3, is a labeled isotopomer of benzene-1,3-diol, commonly referred to as resorcinol. This compound features a benzene ring with two hydroxyl (-OH) groups positioned at the 1 and 3 positions, which contributes to its properties as a dihydroxybenzene derivative. The incorporation of carbon-13 isotopes indicates that this compound is used in various applications, including research and analytical chemistry, particularly in studies involving metabolic pathways or tracing mechanisms. Resorcinol is known for its antiseptic and astringent properties, making it useful in pharmaceuticals and cosmetics. Additionally, it serves as a precursor in the synthesis of various chemical compounds, including dyes and resins. The presence of hydroxyl groups enhances its solubility in water and its reactivity in organic reactions, such as electrophilic substitution. Overall, (~13~C_6_)benzene-1,3-diol is a valuable compound in both industrial and research settings.

Formula: C₆H₆O₂

InChI: InChI=1/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H/i1+1,2+1,3+1,4+1,5+1,6+1

Resorcinol-13C6

CAS: 953390-31-3

Applications Labelled Resorcinol. A benzene derivative used as keratolytic and antiseborrheic. Also used in veterinary medicine as a topical antipruritic and antiseptic (has been used as intestinal antiseptic).
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₆H₆O₂

Color and Shape: Neat

Molecular weight: 116.07

Ref: TR-R144703