CAS 953390-33-5

4-chloro-6-nitroso(~13~C_6_)benzene-1,3-diol

Description:

4-Chloro-6-nitroso-1,3-benzenediol, with the CAS number 953390-33-5, is an organic compound characterized by the presence of a chloro group, a nitroso group, and two hydroxyl groups on a benzene ring. The compound features a chlorinated aromatic structure, which contributes to its reactivity and potential applications in various chemical processes. The nitroso group introduces a strong electron-withdrawing effect, influencing the compound's reactivity and stability. The hydroxyl groups provide sites for hydrogen bonding, enhancing solubility in polar solvents and potentially affecting the compound's biological activity. This compound may exhibit interesting properties such as antioxidant activity or serve as an intermediate in organic synthesis. Its specific applications and behavior in chemical reactions would depend on the context of use, including the presence of other functional groups and the reaction conditions. As with many chlorinated and nitrosated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₆H₄ClNO₃

InChI: InChI=1/C6H4ClNO3/c7-3-1-4(8-11)6(10)2-5(3)9/h1-2,9-10H/i1+1,2+1,3+1,4+1,5+1,6+1

Synonyms:

• 4-Chloro-6-nitrosoresorcinol-13C6
• 4-Chloro-6-nitroso-1,3-benzenediol-1,2,3,4,5,6-13C6

4-Chloro-6-nitrosoresorcinol-13C6

Controlled Product

CAS: 953390-33-5

Applications 4-Chloro-6-nitrosoresorcinol-13C6 (cas# 953390-33-5) is a compound useful in organic synthesis.

Formula: C₆H₄ClNO₃

Color and Shape: Neat

Molecular weight: 179.51

Ref: TR-C374862