CAS 953411-07-9
:B-(6-Methyl-1H-indol-2-yl)boronic acid
Description:
B-(6-Methyl-1H-indol-2-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a 6-methyl-1H-indole moiety. This compound typically exhibits properties associated with both boronic acids and indole derivatives, including potential applications in medicinal chemistry and organic synthesis. The boronic acid group allows for reversible covalent bonding with diols, making it useful in various chemical reactions, including Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds. The indole structure contributes to its biological activity, as indoles are known for their presence in many natural products and pharmaceuticals. Additionally, the methyl group at the 6-position can influence the compound's solubility, reactivity, and interaction with biological targets. Overall, B-(6-Methyl-1H-indol-2-yl)boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C9H10BNO2
InChI:InChI=1S/C9H10BNO2/c1-6-2-3-7-5-9(10(12)13)11-8(7)4-6/h2-5,11-13H,1H3
InChI key:InChIKey=LFXUSTLDJZUIJL-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=2C(N1)=CC(C)=CC2
Synonyms:- Boronic acid, B-(6-methyl-1H-indol-2-yl)-
- B-(6-Methyl-1H-indol-2-yl)boronic acid
- (6-Methyl-1H-indol-2-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
