CymitQuimica logo

CAS 953411-08-0

:

(5-methyl-1H-indol-2-yl)boronic acid

Description:
(5-Methyl-1H-indol-2-yl)boronic acid is an organic compound characterized by the presence of both an indole structure and a boronic acid functional group. The indole moiety contributes to its aromatic properties and potential biological activity, while the boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. This compound typically exhibits moderate solubility in polar solvents and may participate in various chemical reactions, such as Suzuki coupling, which is significant in the synthesis of complex organic molecules. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of the methyl group at the 5-position of the indole ring can influence its electronic properties and reactivity. Overall, (5-methyl-1H-indol-2-yl)boronic acid is a versatile compound with implications in both synthetic and medicinal chemistry.
Formula:C9H10BNO2
InChI:InChI=1/C9H10BNO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11-13H,1H3
SMILES:Cc1ccc2c(c1)cc(B(O)O)[nH]2
Synonyms:
  • boronic acid, B-(5-methyl-1H-indol-2-yl)-
  • 5-METHYL-1H-INDOLE-2-BORONIC ACID
  • 5-methyl-1H-indol-3-ylboronic acid
  • 5-Methyl-1H-indol-2-ylboronic acid
  • B-(5-Methyl-1H-indol-2-yl)boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.