CAS 953414-75-0
:5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine
Description:
5-Bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 5-position and a phenyl group at the 2-position enhances its reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate to high lipophilicity due to the aromatic phenyl group, which can influence its bioavailability and interaction with biological targets. It may also display interesting electronic properties owing to the conjugated system formed by the fused rings. The compound is of interest in the development of pharmaceuticals, particularly in the context of targeting specific receptors or enzymes. Its synthesis and characterization often involve standard organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. Overall, 5-bromo-2-phenyl-1H-pyrrolo[2,3-b]pyridine represents a valuable scaffold in drug discovery and development.
Formula:C13H9BrN2
InChI:InChI=1/C13H9BrN2/c14-11-6-10-7-12(16-13(10)15-8-11)9-4-2-1-3-5-9/h1-8H,(H,15,16)
SMILES:c1ccc(cc1)c1cc2cc(cnc2[nH]1)Br
Synonyms:- 1H-pyrrolo[2,3-b]pyridine, 5-bromo-2-phenyl-
- 5-Brom-2-phenyl-1H-pyrrolo[2,3-b]pyridin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Bromo-2-phenyl-7-azaindole, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C13H9BrN2Purity:97%Color and Shape:Powder, Pale brownMolecular weight:273.13


