CAS 95349-72-7

1-Bromo-2-chloro-4-(chloromethyl)benzene

Description:

1-Bromo-2-chloro-4-(chloromethyl)benzene, with the CAS number 95349-72-7, is an aromatic halogenated compound characterized by the presence of both bromine and chlorine substituents on a benzene ring. This compound features a bromine atom at the first position, a chlorine atom at the second position, and a chloromethyl group (-CH2Cl) at the fourth position of the benzene ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of multiple halogen atoms makes it a subject of interest in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, its halogenated structure may impart specific physical properties, such as increased density and boiling point compared to non-halogenated benzene derivatives. Safety precautions are necessary when handling this compound due to its potential toxicity and environmental impact, particularly concerning halogenated organic compounds.

Formula: C₇H₅BrCl₂

InChI: InChI=1S/C7H5BrCl2/c8-6-2-1-5(4-9)3-7(6)10/h1-3H,4H2

InChI key: InChIKey=YFEABSOSDPYMCL-UHFFFAOYSA-N

SMILES: C(Cl)C1=CC(Cl)=C(Br)C=C1

Synonyms:

• 3-Chloro-4-bromobenzyl chloride
• Benzene, 1-bromo-2-chloro-4-(chloromethyl)-
• 1-Bromo-2-chloro-4-(chloromethyl)benzene

1-Bromo-2-chloro-4-(chloromethyl)benzene

CAS: 95349-72-7

Versatile small molecule scaffold

Formula: C₇H₅BrCl₂

Purity: Min. 95%

Molecular weight: 239.92 g/mol

Ref: 3D-VDA34972