CAS 95350-05-3
:N-(1-phenylethyl)-beta-alanine
Description:
N-(1-phenylethyl)-beta-alanine, with the CAS number 95350-05-3, is an amino acid derivative characterized by its unique structure, which includes a beta-alanine backbone and a phenylethyl group. This compound typically exhibits properties associated with amino acids, such as being a zwitterion at physiological pH, which means it can carry both a positive and a negative charge. It is soluble in polar solvents, reflecting its amino acid nature, and may participate in various biochemical reactions, including peptide bond formation. The presence of the phenylethyl group can influence its hydrophobicity and biological activity, potentially affecting its interaction with proteins and receptors. This compound may be of interest in pharmaceutical research, particularly in the development of new drugs or as a biochemical probe due to its structural features. Additionally, its synthesis and characterization can provide insights into the behavior of amino acid derivatives in biological systems.
Formula:C11H15NO2
InChI:InChI=1/C11H15NO2/c1-9(12-8-7-11(13)14)10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3,(H,13,14)
SMILES:CC(c1ccccc1)NCCC(=O)O
Synonyms:- 3-[(1-Phenylethyl)Amino]Propanoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.