CAS 95355-49-0

2-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]acetic acid

Description:

2-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]acetic acid, with the CAS number 95355-49-0, is a chemical compound characterized by its unique structure that includes a pyridine ring substituted with a chlorine atom and a trifluoromethyl group. This compound is typically classified as an organic acid due to the presence of the carboxylic acid functional group (-COOH). It exhibits properties such as moderate solubility in polar solvents, which is common for compounds containing both aromatic and polar functional groups. The presence of the trifluoromethyl group often imparts significant lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. Additionally, the chlorine substituent can enhance the compound's reactivity and stability under certain conditions. Overall, this compound's unique structural features contribute to its potential applications in various fields, including agrochemicals and medicinal chemistry.

Formula: C₈H₅ClF₃NO₃

InChI: InChI=1S/C8H5ClF3NO3/c9-5-1-4(8(10,11)12)2-13-7(5)16-3-6(14)15/h1-2H,3H2,(H,14,15)

InChI key: InChIKey=KSOSHSKOOHNGKW-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(Cl)C(OCC(O)=O)=NC1

Synonyms:

• 2-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]acetic acid
• Acetic acid, [[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-
• Acetic acid, 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-

2-[[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]oxy]acetic acid

CAS: 95355-49-0

2-[[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]oxy]acetic acid

Purity: 95%

Molecular weight: 255.58g/mol

Ref: 54-PC400633