CymitQuimica logo

CAS 953716-40-0

:

N-(4-Aminophenyl)-2-(2,6-dimethylphenoxy)acetamide

Description:
N-(4-Aminophenyl)-2-(2,6-dimethylphenoxy)acetamide, identified by its CAS number 953716-40-0, is a chemical compound that features a complex structure characterized by an acetamide functional group linked to an aminophenyl moiety and a dimethylphenoxy group. This compound typically exhibits properties associated with both amines and phenolic compounds, such as potential solubility in organic solvents and moderate polarity. The presence of the amino group suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with biological systems. Additionally, the dimethylphenoxy group may contribute to its lipophilicity, affecting its pharmacokinetic properties if considered for pharmaceutical applications. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of therapeutic agents, due to the presence of functional groups that can participate in various chemical reactions. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C16H18N2O2
InChI:InChI=1S/C16H18N2O2/c1-11-4-3-5-12(2)16(11)20-10-15(19)18-14-8-6-13(17)7-9-14/h3-9H,10,17H2,1-2H3,(H,18,19)
InChI key:InChIKey=ZVYCBRBAZQEZTM-UHFFFAOYSA-N
SMILES:O(CC(NC1=CC=C(N)C=C1)=O)C2=C(C)C=CC=C2C
Synonyms:
  • Acetamide, N-(4-aminophenyl)-2-(2,6-dimethylphenoxy)-
  • N-(4-Aminophenyl)-2-(2,6-dimethylphenoxy)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.