CymitQuimica logo

CAS 953719-01-2

:

N-(3-Amino-2-methylphenyl)-2-[2-(1-methylethyl)phenoxy]acetamide

Description:
N-(3-Amino-2-methylphenyl)-2-[2-(1-methylethyl)phenoxy]acetamide, with the CAS number 953719-01-2, is a chemical compound characterized by its complex structure, which includes an acetamide functional group and a phenoxy moiety. This compound features an amino group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The presence of the isopropyl group in the phenoxy portion contributes to its hydrophobic characteristics, potentially influencing its biological activity and interactions with other molecules. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the presence of multiple aromatic rings may contribute to its stability and reactivity. As with many organic compounds, its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions under which they are measured. Further studies would be necessary to fully elucidate its chemical behavior and potential applications.
Formula:C18H22N2O2
InChI:InChI=1S/C18H22N2O2/c1-12(2)14-7-4-5-10-17(14)22-11-18(21)20-16-9-6-8-15(19)13(16)3/h4-10,12H,11,19H2,1-3H3,(H,20,21)
InChI key:InChIKey=ITNMDBCEYGRPPR-UHFFFAOYSA-N
SMILES:O(CC(NC1=C(C)C(N)=CC=C1)=O)C2=C(C(C)C)C=CC=C2
Synonyms:
  • Acetamide, N-(3-amino-2-methylphenyl)-2-[2-(1-methylethyl)phenoxy]-
  • N-(3-Amino-2-methylphenyl)-2-[2-(1-methylethyl)phenoxy]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.